| Identification | |
| Name: | Cyanodimethylarsine |
| Synonyms: | Cyanodimethylarsenic;Cyanodimethylarsine;Dimethylcyanoarsine |
| CAS: | 683-45-4 |
| Molecular Formula: | C3H6AsN |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C3H6AsN/c1-4(2)3-5/h1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 4.2°C |
| Boiling Point: | 99°C at 760 mmHg |
| Report: |
Cyanide and its compounds, as well as arsenic and its compounds, are on the Community Right-To-Know List. |
| Flash Point: | 4.2°C |
| Safety Data | |
 |
|
