| Identification | |
| Name: | Potassium isopropoxide |
| Synonyms: | 2-propanol, potassium salt (1:1);Potassium isopropylate;Potassiumisopropanolate;Potassium i-propoxide;Potassium propan-2-olate; |
| CAS: | 6831-82-9 |
| EINECS: | 229-909-2 |
| Molecular Formula: | C3H7KO |
| Molecular Weight: | 98.18538 |
| InChI: | InChI=1S/C3H7O.K/c1-3(2)4;/h3H,1-2H3;/q-1;+1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Melting Point: | -89 C |
| Boiling Point: | 82 - 84 C |
| Density: | 0,86 g/cm3 |
| Water Solubility: | AUTOIGNITION |
| Solubility: | AUTOIGNITION |
| Appearance: | Colourless to pale yellow liquid |
| Specification: | Safety Statements:16-26-36/37/39 16:Keep away from sources of ignition - No smoking 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice 36/37/39:Wear suitable protective clothing, gloves and eye/face protection |
| Packinggroup: | II |
| Sensitive: | Moisture Sensitive |
| Safety Data | |
| Hazard Symbols |
8 (Packaging Group: I)
|
 |
|
