| Identification | |
| Name: | Benzenebutanoylchloride, 4-methoxy- |
| Synonyms: | Butyrylchloride, 4-(p-methoxyphenyl)- (8CI);4-(4-Methoxyphenyl)butanoyl chloride;4-(p-Methoxyphenyl)butyryl chloride;4-(4-methoxyphenyl)Butyryl chloride; |
| CAS: | 6836-18-6 |
| Molecular Formula: | C11H15ClO |
| Molecular Weight: | 198.69 |
| InChI: | InChI=1/C11H13ClO2/c1-14-10-7-5-9(6-8-10)3-2-4-11(12)13/h5-8H,2-4H2,1H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 1.132 g/cm3 |
| Refractive index: | 1.515 |
| Specification: |
The 4-(4-Methoxyphenyl)butyl chloride with the cas number 6836-18-6, is also called Benzenebutanoyl chloride, 4-methoxy-.The properties of the chemical are: (1)ACD/LogP: 3.00; (2)# of Rule of 5 Violations: 0; (3)ACD/LogD (pH 5.5): 3; (4)ACD/LogD (pH 7.4): 3; (5)ACD/BCF (pH 5.5): 111.47; (6)ACD/BCF (pH 7.4): 111.47; (7)ACD/KOC (pH 5.5): 1016.14; (8)ACD/KOC (pH 7.4): 1016.14; (9)#H bond acceptors: 2; (10)#H bond donors: 0; (11)#Freely Rotating Bonds: 5; (12)Polar Surface Area: 26.3Å2; (13)Index of Refraction: 1.515; (14)Molar Refractivity: 56.62 cm3; (15)Molar Volume: 187.7 cm3; (16)Polarizability: 22.44×10-24cm3; (17)Surface Tension: 37.1 dyne/cm; (18)Enthalpy of Vaporization: 54.84 kJ/mol; (19)Vapour Pressure: 0.000711 mmHg at 25°C. The product can be supplied by the following suppliers: (1)TAIYUAN RHF CO.,LTD.; (2)DSL Chemicals (Shanghai) Co., Ltd.; (3)Kinbester Co., Ltd.; (4)DAMING CHANGDA CO.,LTD.; (5)AndaChem, Inc.; (6)Chengdu Chuanke Fine Chemicals Co., Ltd.; (7)Xiamen Flint Chemical Co., Ltd.. You can still convert the following datas into molecular structure: |
| Safety Data | |
 |
|
