| Identification | |
| Name: | 9,10-Anthracenedione,1,5-dichloro-4,8-dihydroxy- |
| Synonyms: | Anthraquinone,1,5-dichloro-4,8-dihydroxy- (6CI,8CI);1,5-Dichloro-4,8-dihydroxy-anthraquinone; 4,8-Dichloroanthrarufin; NSC 227208;NSC 30461 |
| CAS: | 6837-97-4 |
| EINECS: | 229-924-4 |
| Molecular Formula: | C14H6 Cl2 O4 |
| Molecular Weight: | 309.10 |
| InChI: | InChI=1/C14H6Cl2O4/c15-5-1-3-7(17)11-9(5)13(19)12-8(18)4-2-6(16)10(12)14(11)20/h1-4,17-18H |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 290.2°C |
| Boiling Point: | 556.3°C at 760 mmHg |
| Density: | 1.718g/cm3 |
| Refractive index: | 1.735 |
| Specification: |
4,8-Dichloro-1,5-dihydroxyanthra-quinone ,its CAS number is 6837-97-4,it can be called 1,5-dichloro-4,8-dihydroxyanthraquinone ; 1,5-Dichloro-4,8-dihydroxy-9,10-anthraquinone and 1,5-Dichloro-4,8-dihydroxy-9,10-anthraquinone . |
| Report: |
EPA Genetic Toxicology Program. Reported in EPA TSCA Inventory. |
| Flash Point: | 290.2°C |
| Safety Data | |
 |
|
