Identification |
Name: | 9-Octadecenoic acid (9Z)-, ester with 2,2'-(methylimino)bis[ethanol] |
Synonyms: | 9-Octadecenoic acid (9Z)-, ester with 2,2'-(methylimino)bis[ethanol] |
CAS: | 68389-49-1 |
Molecular Formula: | C23H42N2O3 |
Molecular Weight: | 0 |
InChI: | InChI=1/C23H42N2O3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-23(27)28-21-19-25-22-24-18-20-26/h9-10,26H,2-8,11-21H2,1H3/b10-9- |
Molecular Structure: |
![(C23H42N2O3) 9-Octadecenoic acid (9Z)-, ester with 2,2'-(methylimino)bis[ethanol]](https://img.guidechem.com/crawlimg/68389-49-1.png) |
Properties |
Flash Point: | 256.2°C |
Boiling Point: | 500°C at 760 mmHg |
Density: | 0.95g/cm3 |
Refractive index: | 1.482 |
Flash Point: | 256.2°C |
Safety Data |
|
![](/images/detail_15.png) |