Identification |
Name: | 2-Butenedioic acid (2E)-, polymer with methyloxirane and oxirane |
Synonyms: | 2-Butenedioic acid (2E)-, polymer with methyloxirane and oxirane;2-Butenedioic acid (E)-, polymer with methyloxirane and oxirane;2-Butenedioic acid (2E)-, polymer with 2-methyloxirane and oxirane;Fumaric acid, methyloxirane, oxirane polymer |
CAS: | 68400-72-6 |
Molecular Formula: | C9H14O6 |
Molecular Weight: | 218.20386 |
InChI: | InChI=1S/C4H4O4.C3H6O.C2H4O/c5-3(6)1-2-4(7)8;1-3-2-4-3;1-2-3-1/h1-2H,(H,5,6)(H,7,8);3H,2H2,1H3;1-2H2/b2-1+;; |
Molecular Structure: |
|
Properties |
Flash Point: | 183°C |
Boiling Point: | 355.5°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 183°C |
Safety Data |
|
|