| Identification | |
| Name: | Aromatichydrocarbons, biphenyl-rich |
| Synonyms: | Biphenyl rich aromatic hydrocarbons;Distilled hydrodealkylized toluene;biphenyl |
| CAS: | 68409-73-4 |
| EINECS: | 270-059-7 |
| Molecular Formula: | C12H10 |
| Molecular Weight: | 154.2078 |
| InChI: | InChI=1/C12H10/c1-3-7-11(8-4-1)12-9-5-2-6-10-12/h1-10H |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 69 deg C |
| Flash Point: | 105.5°C |
| Boiling Point: | 258°Cat760mmHg |
| Density: | 0.996g/cm3 |
| Refractive index: | 1.571 |
| Solubility: | Soluble in ethanol, ethyl ether; very soluble in benzene, carbon tetrachloride, carbon disulfide, and methanol. Soluble in alcohol, ether; very soluble in benzene Soluble in oxygenated and chlorinated solvents. In water, 7.48 mg/L at 25 deg C |
| Flash Point: | 105.5°C |
| Color: | White scales Colorless leaflets Pure biphenyl is a white crystalline solid that separates from solvents as plates or monoclinic prismatic crystals. Commercial samples are often slightly yellow or tan in color. |
| Safety Data | |
 |
|
