Identification |
Name: | Dodecanoic acid, mixed esters with decanoic acid, octanoic acid and trimethylolethane |
Synonyms: | Trimethylolethane caprylate, caprate, laurate;Trimethylolethane octanoate decanoate laurate;1-(decanoyloxy)-2-(octanoyloxy)ethyl dodecanoate |
CAS: | 68411-73-4 |
EINECS: | 270-143-3 |
Molecular Formula: | C32H60O6 |
Molecular Weight: | 540.8152 |
InChI: | InChI=1/C32H60O6/c1-4-7-10-13-15-16-18-21-24-27-31(35)38-32(28-36-29(33)25-22-19-12-9-6-3)37-30(34)26-23-20-17-14-11-8-5-2/h32H,4-28H2,1-3H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 238.2°C |
Boiling Point: | 586.9°C at 760 mmHg |
Density: | 0.952g/cm3 |
Refractive index: | 1.46 |
Flash Point: | 238.2°C |
Safety Data |
|
 |