Identification |
Name: | N-(Cocoyl)sarcosine, triethanolamine salt |
Synonyms: | TEA-COCOYL SARCOSINATE;Glycine, N-methyl-, N-coco acyl derivs., compds. with triethanolamine |
CAS: | 68411-96-1 |
Molecular Formula: | C9H22N2O5 |
Molecular Weight: | 0 |
InChI: | InChI=1/C6H15NO3.C3H7NO2/c8-4-1-7(2-5-9)3-6-10;1-4-2-3(5)6/h8-10H,1-6H2;4H,2H2,1H3,(H,5,6) |
Molecular Structure: |
 |
Properties |
Flash Point: | 185°C |
Boiling Point: | 335.4°C at 760 mmHg |
Flash Point: | 185°C |
Safety Data |
|
 |