| Identification |
| Name: | 9-Octadecenoic acid (Z)-, reaction products with triethylenetetramine |
| Synonyms: | 9-Octadecenoic acid (9Z)-, reaction products with triethylenetetramine;Oleic acid, reaction products with triethylene tetramine;Oleic acid, triethylenetetramine amides;Oleic acid, triethylenetetramine reaction product;(9Z)-octadec-9-enoic acid - N,N'-bis(2-aminoethyl)ethane-1,2-diamine (1:1) |
| CAS: | 68412-09-9 |
| EINECS: | 270-165-3 |
| Molecular Formula: | C24H52N4O2 |
| Molecular Weight: | 428.6953 |
| InChI: | InChI=1/C18H34O2.C6H18N4/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;7-1-3-9-5-6-10-4-2-8/h9-10H,2-8,11-17H2,1H3,(H,19,20);9-10H,1-8H2/b10-9-; |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 270.1°C |
| Boiling Point: | 360°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 270.1°C |
| Safety Data |
| |
 |
