| Identification |
| Name: | Octadecanoic acid, reaction products with diethylenetriamine |
| Synonyms: | Reaction products of stearic acid with diethylenetriamine;Stearic acid, diethylenetriamine amide;Stearic acid, diethylenetriamine condensate;octadecanoic acid - N-(2-aminoethyl)ethane-1,2-diamine (1:1) |
| CAS: | 68412-13-5 |
| EINECS: | 270-169-5 |
| Molecular Formula: | C22H49N3O2 |
| Molecular Weight: | 387.6434 |
| InChI: | InChI=1/C18H36O2.C4H13N3/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-3-7-4-2-6/h2-17H2,1H3,(H,19,20);7H,1-6H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 162.4°C |
| Boiling Point: | 359.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 162.4°C |
| Safety Data |
| |
 |
