| Identification |
| Name: | Sulfuric acid, mono-C8-30-alkyl esters, compds. with triethanolamine |
| Synonyms: | Mixed (C8-C30) alcohols, sulfated, triethanolamine salt;Sulfuric acid, mono-C8-3O-alkyl esters, compds. with triethanolamine;2-(bis(2-hydroxyethyl)amino)ethanol sulfate |
| CAS: | 68412-83-9 |
| EINECS: | 270-212-8 |
| Molecular Formula: | C6H15NO7S |
| Molecular Weight: | 245.2519 |
| InChI: | InChI=1/C6H15NO3.H2O4S/c8-4-1-7(2-5-9)3-6-10;1-5(2,3)4/h8-10H,1-6H2;(H2,1,2,3,4)/p-2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 185°C |
| Boiling Point: | 335.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 185°C |
| Safety Data |
| |
 |
