| Identification | |
| Name: | Nitrosomethylphenylcarbamate |
| Synonyms: | Nitrosomethylphenylcarbamate;Phenyl methylnitrosocarbamate;N-Nitroso-N-methylphenylcarbamate;BRN 2264986;CARBAMIC ACID, N-METHYL-N-NITROSO-, PHENYL ESTER;68426-46-0;AC1L18MQ;phenyl methyl(nitroso)carbamate;phenyl N-methyl-N-nitrosocarbamate;LS-50306 |
| CAS: | 68426-46-0 |
| Molecular Formula: | C8H8N2O3 |
| Molecular Weight: | 180.1607 |
| InChI: | InChI=1/C8H8N2O3/c1-10(9-12)8(11)13-7-5-3-2-4-6-7/h2-6H,1H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 100.8°C |
| Boiling Point: | 243°C at 760 mmHg |
| Density: | 1.21g/cm3 |
| Refractive index: | 1.542 |
| Specification: |
Nitrosomethylphenylcarbamate , its cas register number is 68426-46-0. It also can be called Phenyl methylnitrosocarbamate ; N-Nitroso-N-methylphenylcarbamate ; and Carbamic acid, N-methyl-N-nitroso-, phenyl ester . |
| Flash Point: | 100.8°C |
| Safety Data | |
 |
|
