| Identification | |
| Name: | Amines,C12-16-alkyldimethyl |
| Synonyms: | C12-16-alkyldimethylamines; Tertiary amines, C12-16-alkyldimethyl |
| CAS: | 68439-70-3 |
| EINECS: | 270-414-6 R(CH3)2N |
| Molecular Formula: | C28H59N |
| Molecular Weight: | 269.50896 |
| InChI: | InChI=1S/C18H39N/c1-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19(2)3/h4-18H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 160kgs |
| Density: | 0.809 g/cm3 |
| Refractive index: | 1.448 |
| Water Solubility: | Insoluble (soluble in alcohol, ether) |
| Solubility: | Insoluble (soluble in alcohol, ether)
Appearance:yellow
semi-solid Transport Information:160kgs Hazard Symbols:8 (Packing group: II) UN NO. |
| Appearance: | yellow semi-solid |
| Packinggroup: | III |
| Usage: | Barlene(R) tertiary amines are used as chemical intermediates for the manufacture of quaternary ammonium compounds, amine oxide and betaine surfactants |
| Safety Data | |
| Hazard Symbols |
8 (Packing group: II)
UN
NO.
|
 |
|
