| Identification | |
| Name: | 1,2-diethenylbenzene: N,N-dimethylmethanamine: styrene |
| Synonyms: | 1,2-diethenylbenzene: N,N-dimethylmethanamine: styrene;Benzene, diethenyl-, polymer with ethenylbenzene, chloromethylated,trimethylamine-quaternized;Styrene, divinylbenzene polymer, chloromethylated, trimethylamine quaternary ammonium chloride;DIETHENYLBENZENE, POLYMER WITH ETHENYLBENZENE, CHLOROMETHYLATED, TRIMETHYLAMINE-QUATERNIZED;styrene/divinylbenzene, chloromethylated, trimethylamine |
| CAS: | 68441-30-5 |
| Molecular Formula: | C21H27N |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C10H10.C8H8.C3H9N/c1-3-9-7-5-6-8-10(9)4-2;1-2-8-6-4-3-5-7-8;1-4(2)3/h3-8H,1-2H2;2-7H,1H2;1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 71.9°C |
| Boiling Point: | 207.3°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 71.9°C |
| Safety Data | |
 |
|
