Identification |
Name: | 1,3-Butadiene,2-methyl-, homopolymer, chlorinated |
Synonyms: | POLYISOPRENE, CHLORINATED;RUBBER CHLORINATED;1,3-Butadiene,2-methyl-,homopolymer,chlorinated;Chloriertes Polyisopren, Gehalt an Tetrachlorkohlenstoff ;chloroisoprene homopolymer |
CAS: | 68441-58-7 |
EINECS: | 201-143-3 |
Molecular Formula: | [CR2CR=C(CR3)CR2]n,R=HorCl |
Molecular Weight: | 68.117 |
InChI: | InChI=1S/C5H8/c1-4-5(2)3/h4H,1-2H2,3H3 |
Molecular Structure: |
|
Properties |
Melting Point: | -145.9 deg C |
Flash Point: | °C |
Density: | 0.674 g/cm3 |
Solubility: | Miscible with ethanol, ethyl ether, acetone, benzene Water solubility of 642 ppm at 25 deg C Soluble in alcohol, ether and acetone |
Flash Point: | °C |
Color: | Colorless volatile liquid |
Safety Data |
|
|