| Identification | |
| Name: | Pentaerythrityl tetracaprylate/tetracaprate |
| Synonyms: | Decanoic acid, mixed esters with octanoic acid and pentaerythritol;PENTAERYTHRITYL TETRACAPRYLATE/TETRACAPRATE;Decansaure, gemischte Ester mit Octansaure und Pentaerythritol;Decanoic/octanoic acid pentaerythrityl ester;decanoic/octanoic acid, esters with pentaerythritol |
| CAS: | 68441-68-9 |
| EINECS: | 270-472-2 |
| Molecular Formula: | C77H148O16 |
| Molecular Weight: | 1329.98942 |
| InChI: | InChI=1/C10H20O2.C8H16O2.C5H12O4/c1-2-3-4-5-6-7-8-9-10(11)12;1-2-3-4-5-6-7-8(9)10;6-1-5(2-7,3-8)4-9/h2-9H2,1H3,(H,11,12);2-7H2,1H3,(H,9,10);6-9H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 121.8°C |
| Boiling Point: | 269.6°C at 760 mmHg |
| Flash Point: | 121.8°C |
| Safety Data | |
 |
|
