| Identification | |
| Name: | benzoic acid, compound with N,N-dimethyldodecylamine (1:1) |
| Synonyms: | 1-Dodecanamine, N,N-dimethyl-, benzoate (1:1);Dimethyllaurylamine benzoate;1-Dodecanamine, N,N-dimethyl-, benzoate;Benzoic acid, compound with N,N-dimethyldodecylamine (1:1);N,N-dimethyldodecan-1-amine benzoate (1:1) |
| CAS: | 68473-31-4 |
| EINECS: | 270-638-4 |
| Molecular Formula: | C21H37NO2 |
| Molecular Weight: | 335.524 |
| InChI: | InChI=1/C14H31N.C7H6O2/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3;8-7(9)6-4-2-1-3-5-6/h4-14H2,1-3H3;1-5H,(H,8,9) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 106.9°C |
| Boiling Point: | 265.2°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 106.9°C |
| Safety Data | |
 |
|
