Identification |
Name: | 1,4-Benzenediamine, reaction products with glycidyl Ph ether and 4,4'-methylenebis[benzenamine] |
Synonyms: | 1,4-Benzenediamine, reaction products with glycidyl Ph ether and 4,4'-methylenebis(benzenamine);4,4'-Methylenedianiline, 1,4-phenylenediamine, phenylglycidylether adduct;4-[(4-aminophenyl)methyl]aniline; benzene-1,4-diamine; 2-(phenoxymethyl)oxirane |
CAS: | 68478-43-3 |
EINECS: | 270-819-8 |
Molecular Formula: | C28H32N4O2 |
Molecular Weight: | 456.5793 |
InChI: | InChI=1/C13H14N2.C9H10O2.C6H8N2/c14-12-5-1-10(2-6-12)9-11-3-7-13(15)8-4-11;1-2-4-8(5-3-1)10-6-9-7-11-9;7-5-1-2-6(8)4-3-5/h1-8H,9,14-15H2;1-5,9H,6-7H2;1-4H,7-8H2 |
Molecular Structure: |
|
Properties |
Flash Point: | 226.3°C |
Boiling Point: | 398°C at 760 mmHg |
Density: | g/cm3 |
Flash Point: | 226.3°C |
Safety Data |
|
|