| Identification |
| Name: | 1,3-Propanediamine, N-[3-(decyloxy)propyl]-, branched and linear |
| Synonyms: | 1,3-Propanediamine, N1-(3-(decyloxy)propyl)-, branched and linear;1,3-Propanediamine, N-(3-(decyloxy)propyl)-, branched and linear;N-{3-[(3-methyl-2-propylhexyl)oxy]propyl}propane-1,3-diamine |
| CAS: | 68479-02-7 |
| EINECS: | 270-850-7 |
| Molecular Formula: | C16H36N2O |
| Molecular Weight: | 272.4698 |
| InChI: | InChI=1/C16H36N2O/c1-4-8-15(3)16(9-5-2)14-19-13-7-12-18-11-6-10-17/h15-16,18H,4-14,17H2,1-3H3 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 176.2°C |
| Boiling Point: | 367.7°C at 760 mmHg |
| Density: | 0.872g/cm3 |
| Refractive index: | 1.456 |
| Flash Point: | 176.2°C |
| Safety Data |
| |
 |
