Identification |
Name: | 1,3-Propanediamine, N-[3-(decyloxy)propyl]-, branched and linear |
Synonyms: | 1,3-Propanediamine, N1-(3-(decyloxy)propyl)-, branched and linear;1,3-Propanediamine, N-(3-(decyloxy)propyl)-, branched and linear;N-{3-[(3-methyl-2-propylhexyl)oxy]propyl}propane-1,3-diamine |
CAS: | 68479-02-7 |
EINECS: | 270-850-7 |
Molecular Formula: | C16H36N2O |
Molecular Weight: | 272.4698 |
InChI: | InChI=1/C16H36N2O/c1-4-8-15(3)16(9-5-2)14-19-13-7-12-18-11-6-10-17/h15-16,18H,4-14,17H2,1-3H3 |
Molecular Structure: |
![(C16H36N2O) 1,3-Propanediamine, N1-(3-(decyloxy)propyl)-, branched and linear;1,3-Propanediamine, N-(3-(decyloxy...](https://img.guidechem.com/pic/image/68479-02-7.gif) |
Properties |
Flash Point: | 176.2°C |
Boiling Point: | 367.7°C at 760 mmHg |
Density: | 0.872g/cm3 |
Refractive index: | 1.456 |
Flash Point: | 176.2°C |
Safety Data |
|
![](/images/detail_15.png) |