| Identification | |
| Name: | 2,2',2''-nitrilotrisethanol, compound with 5-methyl-1H-benzotriazole (1:1) |
| Synonyms: | Ethanol, 2,2',2''-nitrilotris-, compd. with 6-methyl-1H-benzotriazole (1:1);Tolutriazole, triethanolamine salt;2,2',2''-Nitrilotrisethanol, compound with 5-methyl-1H-benzotriazole (1:1);Ethanol, 2,2',2''-nitrilotris-, compd. with 5-methyl-1H-benzotriazole (1:1);2,2',2''-nitrilotriethanol - 5-methyl-2H-benzotriazole (1:1) |
| CAS: | 68480-31-9 |
| EINECS: | 270-909-7 |
| Molecular Formula: | C13H22N4O3 |
| Molecular Weight: | 282.3388 |
| InChI: | InChI=1/C7H7N3.C6H15NO3/c1-5-2-3-6-7(4-5)9-10-8-6;8-4-1-7(2-5-9)3-6-10/h2-4H,1H3,(H,8,9,10);8-10H,1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 185°C |
| Boiling Point: | 335.4°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 185°C |
| Safety Data | |
 |
|
