| Identification | |
| Name: | 2,2'-iminobisethanol, compound with 5-methyl-1H-benzotriazole (1:1) |
| Synonyms: | Ethanol, 2,2'-iminobis-, compd. with 6-methyl-1H-benzotriazole (1:1);Tolutriazole, diethanolamine salt;2,2'-Iminobisethanol, compound with 5-methyl-1H-benzotriazole (1:1);Ethanol, 2,2'-iminobis-, compd. with 5-methyl-1H-benzotriazole (1:1);2,2'-iminodiethanol - 5-methyl-2H-benzotriazole (1:1) |
| CAS: | 68480-33-1 |
| EINECS: | 270-911-8 |
| Molecular Formula: | C11H18N4O2 |
| Molecular Weight: | 238.2862 |
| InChI: | InChI=1/C7H7N3.C4H11NO2/c1-5-2-3-6-7(4-5)9-10-8-6;6-3-1-5-2-4-7/h2-4H,1H3,(H,8,9,10);5-7H,1-4H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 137.4°C |
| Boiling Point: | 289.3°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 137.4°C |
| Safety Data | |
 |
|
