| Identification | |
| Name: | Urea, polymer with formaldehyde, butylated and 2-ethylhexylated |
| Synonyms: | Urea, polymer with formaldehyde, butylated and 2-ethylhexylated |
| CAS: | 68511-66-0 |
| Molecular Formula: | C2H6N2O2 |
| Molecular Weight: | 90.08124 |
| InChI: | InChI=1S/CH4N2O.CH2O/c2-1(3)4;1-2/h(H4,2,3,4);1H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 72.7°C |
| Boiling Point: | 196.6°Cat760mmHg |
| Density: | g/cm3 |
| Solubility: | Solubility in water = 0.28-0.31% |
| Flash Point: | 72.7°C |
| Color: | Amorphous powder |
| Safety Data | |
 |
|
