Identification |
Name: | 1,2-Benzenedicarboxylic acid, benzyl C7-9-branched and linear alkyl esters |
Synonyms: | Benzyl C7-9-branched and linear alkyl phthalates;Phthalic acid, benzyl alkyl(C7-C8) ester;benzyl octyl benzene-1,2-dicarboxylate |
CAS: | 68515-40-2 |
EINECS: | 271-082-5 |
Molecular Formula: | C23H28O4 |
Molecular Weight: | 368.466 |
InChI: | InChI=1/C23H28O4/c1-2-3-4-5-6-12-17-26-22(24)20-15-10-11-16-21(20)23(25)27-18-19-13-8-7-9-14-19/h7-11,13-16H,2-6,12,17-18H2,1H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 222.6°C |
Boiling Point: | 461°C at 760 mmHg |
Density: | 1.079g/cm3 |
Refractive index: | 1.537 |
Flash Point: | 222.6°C |
Safety Data |
|
 |