Identification |
Name: | 1,2,4-Benzenetricarboxylic acid, mixed branched and linear heptyl and nonyl and undecyl esters |
Synonyms: | Mixed branched and linear heptyl and nonyl and undecyl trimellitates;Trimellitic acid, trialkyl(C7,C9,C11) ester;2-(2-ethyl-3-methylbutyl) 1-(2-ethyl-3-methylhexyl) 4-(5-ethyl-6-methyloctyl) benzene-1,2,4-tricarboxylate |
CAS: | 68515-58-2 |
EINECS: | 271-100-1 |
Molecular Formula: | C36H60O6 |
Molecular Weight: | 588.858 |
InChI: | InChI=1/C36H60O6/c1-10-17-27(9)30(14-5)24-42-35(38)32-20-19-31(22-33(32)36(39)41-23-29(13-4)25(6)7)34(37)40-21-16-15-18-28(12-3)26(8)11-2/h19-20,22,25-30H,10-18,21,23-24H2,1-9H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 244.6°C |
Boiling Point: | 608.5°C at 760 mmHg |
Density: | 0.978g/cm3 |
Refractive index: | 1.485 |
Flash Point: | 244.6°C |
Safety Data |
|
 |