| Identification | |
| Name: | 2-methoxy-5-nitrobenzenediazonium chloride, compound with zinc chloride |
| Synonyms: | Benzenediazonium, 2-methoxy-5-nitro-, chloride, compd. with zinc chloride (ZnCl2) (1:1:?);2-Methoxy-5-nitrobenzenediazonium chloride, compound with zinc chloride;Benzenediazonium, 2-methoxy-5-nitro-, chloride, compd. with zinc chloride (ZnCl2);2-methoxy-5-nitrobenzenediazonium zinc chloride (1:1:3) |
| CAS: | 68540-75-0 |
| EINECS: | 271-309-8 |
| Molecular Formula: | C7H6Cl3N3O3Zn |
| Molecular Weight: | 351.9088 |
| InChI: | InChI=1/C7H6N3O3.3ClH.Zn/c1-13-7-3-2-5(10(11)12)4-6(7)9-8;;;;/h2-4H,1H3;3*1H;/q+1;;;;+2/p-3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | °C |
| Boiling Point: | °Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | °C |
| Safety Data | |
 |
|
