| Identification | |
| Name: | Isoalkanes, C13-16 |
| Synonyms: | Alkanes,C13-16-iso-;C13-16 isoalkanes;Isofol 400; |
| CAS: | 68551-20-2 |
| EINECS: | 271-370-0 |
| Molecular Formula: | C15H32 |
| Molecular Weight: | 212.418 |
| InChI: | InChI=1/C15H32/c1-4-5-6-7-8-9-10-11-12-13-14-15(2)3/h15H,4-14H2,1-3H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.768 g/cm3 |
| Refractive index: | 1.43 |
| Specification: |
The C13-C16 Isoparaffin ,its cas register number is 68551-20-2.It also can be called as Alkanes, C13-16-iso- and the IUPAC name about this chemicals is 2-Methyltetradecane .Classification Code about this chemical is TSCA UVCB. Following are the chemical properties about C13-C16 Isoparaffin :(1)#H bond acceptors: 0 ; (2)#H bond donors: 0 ; (3)#Freely Rotating Bonds: 11 ; (4)Polar Surface Area: 0Å2 ; (5)Index of Refraction: 1.43; (6)Molar Refractivity: 71.5 cm3 ; (7)Molar Volume: 276.5 cm3 ; (8)Polarizability: 28.34x10-24cm3 ; (9)Surface Tension: 26.3 dyne/cm ; (10)Enthalpy of Vaporization: 47.92 kJ/mol ; (11)Vapour Pressure: 0.0186 mmHg at 25°C This chemicals can be described computed from structure: |
| Safety Data | |
 |
|
