| Identification | |
| Name: | 4H-Pyran-4-one,2-methyl-3-(1-oxopropoxy)- |
| Synonyms: | Maltolpropionate;Maltol propionate;2-Methyl-3-(1-oxopropoxy)-4H-pyran-4-one; |
| CAS: | 68555-63-5 |
| EINECS: | 271-440-0 |
| Molecular Formula: | C9H10O4 |
| Molecular Weight: | 182.1733 |
| InChI: | InChI=1S/C9H10O4/c1-3-8(11)13-9-6(2)12-5-4-7(9)10/h4-5H,3H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Melting Point: | 49 ºC |
| Flash Point: | 141.5 ºC |
| Boiling Point: | 317.8 ºC at 760 mmHg |
| Density: | 1.19 g/cm3 |
| Refractive index: | 1.5 |
| Water Solubility: | Insoluble in water; Soluble in fats |
| Solubility: | Insoluble in water; Soluble in fats |
| Appearance: | Light yellow liquid or solid |
| Specification: |
4H-Pyran-4-one,2-methyl-3-(1-oxopropoxy)- , its cas register number is 68555-63-5. It also can be called Maltol propionate ; 2-Methyl-3-(1-oxopropoxy)-4H-pyran-4-one and so on. |
| Flash Point: | 141.5 ºC |
| Safety Data | |
 |
|
