| Identification | |
| Name: | 2-Propanone, polymer with 1,2,3-benzenetriol, 6-diazo-5,6-2-Propanone, polymer with 1,2,3-benzenetriol, 6-diazo-5,6- |
| Synonyms: | Acetone-pyrogallol copolymer 1,2-diazonaphthoquinone-5-; |
| CAS: | 68584-99-6 |
| Molecular Formula: | C10H6N2O4S.x-(C6H6O3.C3H6O)x |
| Molecular Weight: | 0 |
| Molecular Structure: |  |
| Properties | |
| Specification: |
2-Propanone, polymer with 1,2,3-benzenetriol, 6-diazo-5,6- , its cas register number is 68584-99-6. It belongs to a mixture of compounds which formed by three compounds. |
| Safety Data | |
 |
|
