| Identification | |
| Name: | Quaternized stearic imidazoline amide |
| Synonyms: | Quaternized stearic imidazoline amide;Reaction products of stearic acid with diethylenetriamine, diethyl sulfate quaternized;N-(2-aminoethyl)ethane-1,2-diamine; diethyl sulfate; stearic acid |
| CAS: | 68585-05-7 |
| EINECS: | 271-548-8 |
| Molecular Formula: | C26H59N3O6S |
| Molecular Weight: | 541.8282 |
| InChI: | InChI=1/C18H36O2.C4H13N3.C4H10O4S/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;5-1-3-7-4-2-6;1-3-7-9(5,6)8-4-2/h2-17H2,1H3,(H,19,20);7H,1-6H2;3-4H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 162.4°C |
| Boiling Point: | 359.4°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 162.4°C |
| Safety Data | |
 |
|
