| Identification |
| Name: | 2-(bis(2-hydroxyethyl)amino)ethanol: sulfuric acid |
| Synonyms: | C8-10-Alkylalcohol sulfuric acid, triethanolamine salt;Sulfuric acid, mono-C8-10-alkyl esters, compds. with triethanolamine;Alkyl-(C8-C10)-alcohol sulfuric acid triethanolamine salt;(C8-C10) Alkylalcohol sulfuric acid, triethanolamine salt;Sulfuric acid, mono-C8-1o-alkyl esters, compds. with triethanolamine |
| CAS: | 68585-46-6 |
| Molecular Formula: | C6H17NO7S |
| Molecular Weight: | 0 |
| InChI: | InChI=1S/C6H15NO3.H2O4S/c8-4-1-7(2-5-9)3-6-10;1-5(2,3)4/h8-10H,1-6H2;(H2,1,2,3,4) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 185°C |
| Boiling Point: | 335.4°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 185°C |
| Safety Data |
| |
 |
