Identification |
Name: | 2-(bis(2-hydroxyethyl)amino)ethanol: sulfuric acid |
Synonyms: | C8-10-Alkylalcohol sulfuric acid, triethanolamine salt;Sulfuric acid, mono-C8-10-alkyl esters, compds. with triethanolamine;Alkyl-(C8-C10)-alcohol sulfuric acid triethanolamine salt;(C8-C10) Alkylalcohol sulfuric acid, triethanolamine salt;Sulfuric acid, mono-C8-1o-alkyl esters, compds. with triethanolamine |
CAS: | 68585-46-6 |
Molecular Formula: | C6H17NO7S |
Molecular Weight: | 0 |
InChI: | InChI=1S/C6H15NO3.H2O4S/c8-4-1-7(2-5-9)3-6-10;1-5(2,3)4/h8-10H,1-6H2;(H2,1,2,3,4) |
Molecular Structure: |
![(C6H17NO7S) C8-10-Alkylalcohol sulfuric acid, triethanolamine salt;Sulfuric acid, mono-C8-10-alkyl esters, compd...](https://img.guidechem.com/structure/68585-46-6.gif) |
Properties |
Flash Point: | 185°C |
Boiling Point: | 335.4°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 185°C |
Safety Data |
|
![](/images/detail_15.png) |