| Identification | |
| Name: | Thiodicarbonic diamide ([(H2N)C(S)]2S), tetramethyl-, reaction products with 1,2-oxathiolane 2,2-dioxide |
| Synonyms: | Thiodicarbonic diamide (((H2N)C(S))2S), N,N,N',N'-tetramethyl-, reaction products with 1,2-oxathiolane 2,2-dioxide;Thiodicarbonic diamide (((H2N)C(S))2S), tetramethyl-, reaction products with 1,2-oxathiolane 2,2-dioxide;N,N,N',N'-tetramethyldicarbonothioic diamide - 1,2-oxathiolane 2,2-dioxide (1:1) |
| CAS: | 68585-54-6 |
| EINECS: | 271-560-3 |
| Molecular Formula: | C9H18N2O5S2 |
| Molecular Weight: | 298.3796 |
| InChI: | InChI=1/C6H12N2O2S.C3H6O3S/c1-7(2)5(9)11-6(10)8(3)4;4-7(5)3-1-2-6-7/h1-4H3;1-3H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 97.4°C |
| Boiling Point: | 237.5°C at 760 mmHg |
| Flash Point: | 97.4°C |
| Safety Data | |
 |
|
