| Identification |
| Name: | Urea, N,N'-dihydroxy- |
| Synonyms: | Urea,1,3-dihydroxy- (7CI,8CI); Dihydroxyurea; N,N'-Dihydroxyurea; NSC 528762 |
| CAS: | 686-68-0 |
| Molecular Formula: | CH4 N2 O3 |
| Molecular Weight: | 92.05406 |
| InChI: | InChI=1S/CH4N2O3/c4-1(2-5)3-6/h5-6H,(H2,2,3,4) |
| Molecular Structure: |
 |
| Properties |
| Melting Point: | ca. 102 - 106 C (decomposes) |
| Density: | 1.679g/cm3 |
| Refractive index: | 1.531 |
| Water Solubility: | Stability Stable, but should be stored cold. Incompatible with strong oxidizing agents. Toxicology No toxicological data available. Toxicity data (The meaning o |
| Solubility: | |
| Appearance: | colourless crystals |
| Safety Data |
| |
 |
