| Identification | |
| Name: | Fatty acids, C8-18 and C18-unsatd., Me esters, distn. residues |
| Synonyms: | Stillbottoms from distillation of (C8-C18) and C18 unsaturated alkyl carboxylic acid methyl ester;Fatty acids, C8-18 and C18-unsatd, Me esters, distn. residues;methyl (3E,5E,7E,9E,11E)-tetradeca-3,5,7,9,11,13-hexaenoate |
| CAS: | 68604-39-7 |
| EINECS: | 271-690-0 |
| Molecular Formula: | C15H18O2 |
| Molecular Weight: | 230.3022 |
| InChI: | InChI=1/C15H18O2/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(16)17-2/h3-13H,1,14H2,2H3/b5-4+,7-6+,9-8+,11-10+,13-12+ |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 136.5°C |
| Boiling Point: | 353.7°C at 760 mmHg |
| Density: | 0.948g/cm3 |
| Refractive index: | 1.515 |
| Flash Point: | 136.5°C |
| Safety Data | |
 |
|
