Identification |
Name: | 2,5-Furandione, reaction products with polypropylene, chlorinated |
Synonyms: | 2,5-Furandione, reaction products with polypropylene, chlorinated;polypropylene glycol/ maleic anhydride, chlorinated |
CAS: | 68609-36-9 |
Molecular Formula: | C7H8O3 |
Molecular Weight: | 140.13662 |
InChI: | InChI=1S/C4H2O3.C3H6/c5-3-1-2-4(6)7-3;1-3-2/h1-2H;3H,1H2,2H3 |
Molecular Structure: |
 |
Properties |
Flash Point: | 103.3°C |
Boiling Point: | 202°Cat760mmHg |
Density: | g/cm3 |
Flash Point: | 103.3°C |
Safety Data |
|
 |