| Identification | |
| Name: | oleic acid, compound with isopropylamine (1:1) |
| Synonyms: | 9-Octadecenoic acid (9Z)-, compd. with 2-propanamine (1:1);Isopropylamine oleate;Oleic acid, compound with isopropylamine (1:1);(9Z)-octadec-9-enoic acid - propan-2-amine (1:1) |
| CAS: | 68650-93-1 |
| EINECS: | 272-049-8 |
| Molecular Formula: | C21H43NO2 |
| Molecular Weight: | 341.5716 |
| InChI: | InChI=1/C18H34O2.C3H9N/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20;1-3(2)4/h9-10H,2-8,11-17H2,1H3,(H,19,20);3H,4H2,1-2H3/b10-9-; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 270.1°C |
| Boiling Point: | 360°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 270.1°C |
| Safety Data | |
 |
|
