| Identification | |
| Name: | 2-(4-isopropylcyclohexadienyl)ethylformate |
| Synonyms: | 2-(4-isopropylcyclohexadienyl)ethylformate;4-(1-methylethyl)cyclohexadiene-1-ethanolformate;isobergamate |
| CAS: | 68683-20-5 |
| EINECS: | 272-066-0 |
| Molecular Formula: | C12H18O2 |
| Molecular Weight: | 194.2701 |
| InChI: | InChI=1/C12H18O2/c1-10(2)12-5-3-11(4-6-12)7-8-14-9-13/h3,6,9-10H,4-5,7-8H2,1-2H3 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 120.4°C |
| Boiling Point: | 271°C at 760 mmHg |
| Density: | 0.976g/cm3 |
| Refractive index: | 1.481 |
| Specification: |
Isobergamate with cas registry number of 68683-20-5 is also known as 2-(4-Isopropylcyclohexadienyl)ethyl formate ; 4-(1-Methylethyl)cyclohexadiene-1-ethanol formate ; 4-(1-Methylethyl)cyclohexadiene-1-ethyl formate ; 4-(Isopropyl)cyclohexadiene-1-ethyl formate ; Formic acid, (menthadien-7-methanyl) ester ; Menthadiene-7-methyl formate ; Menthadienyl formate ; Menthadienyl formiate ; 1,?-Cyclohexadiene-1-ethanol, 4-(1-methylethyl)-, 1-formate ; 1,?-Cyclohexadiene-1-ethanol, 4-(1-methylethyl)-, formate ; Cyclohexadiene-1-ethanol, 4-(1-methylethyl)-, formate ; Cyclohexadieneethanol, 4-(1-methylethyl)-, formate . |
| Report: |
Reported in EPA TSCA Inventory. |
| Flash Point: | 120.4°C |
| Safety Data | |
 |
|
