| Identification | |
| Name: | Ethyl L(-)-lactate |
| Synonyms: | Ethyl L-lactate; L-Lactic acid ethyl ester; Ethyl-(S)-2-hydroxypropionate; Richtig: s. TCL0162 L-(-)-Lactic acid ethyl ester; L-Ethyl Lactate |
| CAS: | 687-47-8 |
| EINECS: | 211-694-1 |
| Molecular Formula: | C5H10O3 |
| Molecular Weight: | 118.13 |
| InChI: | InChI=1/C5H10O3/c1-3-8-5(7)4(2)6/h4,6H,3H2,1-2H3/t4-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 1192 |
| Density: | 1.034 |
| Stability: | Stable under normal temperatures and pressures. |
| Refractive index: | 1.42-1.414 |
| Alpha: | -10 o (NEAT) |
| Water Solubility: | SOLUBLE |
| Solubility: | SOLUBLE |
| Appearance: | clear colorless to pale yellow |
| Packinggroup: | III |
| HS Code: | 29181100 |
| Usage: | Production of environmentally friendly solvents. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
