| Identification | |
| Name: | 2-Ethylhexyl methacrylate |
| Synonyms: | - |
| CAS: | 688-84-6 |
| EINECS: | 211-708-6 |
| Molecular Formula: | C12H22O2 |
| Molecular Weight: | 198.3 |
| InChI: | InChI=1/C12H22O2/c1-5-7-8-11(6-2)9-14-12(13)10(3)4/h11H,3,5-9H2,1-2,4H3 |
| Molecular Structure: |  |
| Properties | |
| Density: | 0.884 |
| Stability: | Stable, but may polymerize upon exposure to light. Heat sensitive. Incompatible with strong acids, strong oxidizing agents, strong bases. |
| Refractive index: | 1.437-1.439 |
| Water Solubility: | <0.1 g/L |
| Solubility: | <0.1 g/L in water |
| Appearance: | colourless liquid |
| Specification: |
2-Ethylhexyl methacrylate , its cas register number is 688-84-6. It also can be called 2-Ethyl-1-hexyl methacrylate ; 2-Propenoic acid, 2-methyl-, 2-ethylhexyl ester ; Methacrylate, 2-ethylisohexy ; Methacrylic acid, 2-ethylhexyl ester .It is a colourless liquid. |
| Report: |
Reported in EPA TSCA Inventory. |
| Safety Data | |
| Hazard Symbols |
Xi:Irritant
|
 |
|
