| Identification | |
| Name: | 3-Amino-1,4-dimethyl-5H-pyrido(4,3-b)indole acetate |
| CAS: | 68808-54-8 |
| Molecular Formula: | C13H13N3 . C2H4O2 |
| Molecular Weight: | 271.31 |
| InChI: | InChI=1/C13H13N3.C2H4O2/c1-7-12-11(8(2)15-13(7)14)9-5-3-4-6-10(9)16-12;1-2(3)4/h3-6,16H,1-2H3,(H2,14,15);1H3,(H,3,4) |
| Molecular Structure: | ![(C13H13N3.C2H4O2) TRP-P-1 ACETATE;3-AMINO-1,4-DIMETHYL-5H-PYRIDO[4,3-B]INDOLE, ACETATE;3-b)indol-3-amine,1,4-dimethyl-...](https://img.guidechem.com/crawlimg/68808-54-8.png) |
| Properties | |
| Melting Point: | 250-260 |
| Flash Point: | 263°C |
| Boiling Point: | 460.2°C at 760 mmHg |
| Specification: |
3-Amino-1,4-dimethyl-5H-pyrido(4,3-b)indole acetate (CAS NO.68808-54-8) is also called 5H-Pyrido(4,3-b)indol-3-amine, 1,4-dimethyl-, acetate ; 5H-Pyrido(4,3-b)indol-3-amine, 1,4-dimethyl-, monoacetate ; CCRIS 1409 ; Trp-P-1 (acetate) . 3-Amino-1,4-dimethyl-5H-pyrido(4,3-b)indole acetate (CAS NO.68808-54-8) is beige-brown crystalline solid. 3-Amino-1,4-dimethyl-5H-pyrido(4,3-b)indole acetate (CAS NO.68808-54-8) is toxic. It is flammable. It will produce toxic nitrogen oxide fumes when buring. So the storage environment should be ventilate, low-temperature and dry. |
| Flash Point: | 263°C |
| Usage: |
3-Amino-1,4-dimethyl-5H-pyrido(4,3-b)indole acetate (CAS NO.68808-54-8) is highly mutagenic in the Ames test. Investigations have shown that broiled fish, fried beef and commercial beef extracts, and protein pyrolysates contain this mutagen. |
| Safety Data | |
 |
|
