| Identification | |
| Name: | Decanoic acid, reaction products with 2-[(2-aminoethyl)amino]ethanol, acrylic acid alkylated (1:2) |
| Synonyms: | Decanoic acid, reaction products with 2-((2-aminoethyl)amino)ethanol, acrylic acid alkylated (1:2);acrylic acid; 2-(2-aminoethylamino)ethanol; decanoic acid |
| CAS: | 68815-44-1 |
| EINECS: | 272-372-4 |
| Molecular Formula: | C20H40N2O7 |
| Molecular Weight: | 420.5408 |
| InChI: | InChI=1/C10H20O2.C4H12N2O.2C3H4O2/c1-2-3-4-5-6-7-8-9-10(11)12;5-1-2-6-3-4-7;2*1-2-3(4)5/h2-9H2,1H3,(H,11,12);6-7H,1-5H2;2*2H,1H2,(H,4,5) |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 121.8°C |
| Boiling Point: | 269.6°C at 760 mmHg |
| Flash Point: | 121.8°C |
| Safety Data | |
 |
|
