| Identification |
| Name: | Phosphoric acid, isooctyl ester, compd. with 2,2'-iminobis[ethanol] |
| Synonyms: | Phosphoric acid, isooctyl ester, compd. with 2,2'-iminobis(ethanol);Isooctyl alcohol, phosphate, diethanolamine salt;Ethanol, 2,2'-iminobis-, compd. with isooctyl phosphate;2-(2-hydroxyethylamino)ethanol; 6-methylheptan-1-ol; phosphoric acid |
| CAS: | 68815-68-9 |
| EINECS: | 272-389-7 |
| Molecular Formula: | C12H32NO7P |
| Molecular Weight: | 333.3587 |
| InChI: | InChI=1/C8H18O.C4H11NO2.H3O4P/c1-8(2)6-4-3-5-7-9;6-3-1-5-2-4-7;1-5(2,3)4/h8-9H,3-7H2,1-2H3;5-7H,1-4H2;(H3,1,2,3,4) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 71.1°C |
| Boiling Point: | 179.2°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 71.1°C |
| Safety Data |
| |
 |
