| Identification | |
| Name: | azelaic acid, compound with 2,2',2''-nitrilotriethanol |
| Synonyms: | Nonanedioic acid, compd. with 2,2',2''-nitrilotris(ethanol) (1:?);Azelaic acid, reaction product with triethanolamine;Azelaic acid, compound with 2,2',2''-nitrilotriethanol;Nonanedioic acid, compd. with 2,2',2''-nitrilotris(ethanol);nonanedioic acid - 2,2',2''-nitrilotriethanol (1:1) |
| CAS: | 68833-70-5 |
| EINECS: | 272-413-6 |
| Molecular Formula: | C15H31NO7 |
| Molecular Weight: | 337.4091 |
| InChI: | InChI=1/C9H16O4.C6H15NO3/c10-8(11)6-4-2-1-3-5-7-9(12)13;8-4-1-7(2-5-9)3-6-10/h1-7H2,(H,10,11)(H,12,13);8-10H,1-6H2 |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 192.1°C |
| Boiling Point: | 370.5°C at 760 mmHg |
| Flash Point: | 192.1°C |
| Safety Data | |
 |
|
