| Identification | |
| Name: | 4-Bromo-2-methylbenzoic acid |
| Synonyms: | 2-Methyl -4-Bromobenzoic acid; RARECHEM AL BO 0455; 2-METHYL-4-BROMOBENZOIC ACID; 4-Bromo-o-toluic acid; 4-Bromo-2-Methylbenzoic Acid 2-Methyl-4-Bromobenzoic Acid |
| CAS: | 68837-59-2 |
| EINECS: | 272-437-7 |
| Molecular Formula: | C8H7BrO2 |
| Molecular Weight: | 215.04 |
| InChI: | InChI=1/C8H7BrO2/c1-5-4-6(9)2-3-7(5)8(10)11/h2-4H,1H3,(H,10,11) |
| Molecular Structure: |  |
| Properties | |
| Transport: | UN 2811 |
| Density: | 1.599 g/cm3 |
| Refractive index: | 1.595 |
| Appearance: | White to off-white crystalline powder |
| Specification: |
The extinguishing agent of 4-Bromo-2-methylbenzoic acid (CAS No. 68837-59-2) are dry powder, foam, sand, carbon dioxide, water mist. |
| Safety Data | |
| Hazard Symbols |
Xn:Harmful
|
 |
|
