| Identification |
| Name: | 2-(aminothioxomethyl)dithiocarbazic acid, compound with triethylamine (1:1) |
| Synonyms: | Hydrazinecarbodithioic acid, 2-(aminothioxomethyl)-, compd. with N,N-diethylethanamine (1:1);2-(Aminothioxomethyl)dithiocarbazic acid, compound with triethylamine (1:1);2-carbamothioylhydrazinecarbodithioic acid - N,N-diethylethanamine (1:1) |
| CAS: | 68901-19-9 |
| EINECS: | 272-662-0 |
| Molecular Formula: | C8H20N4S3 |
| Molecular Weight: | 268.4662 |
| InChI: | InChI=1/C6H15N.C2H5N3S3/c1-4-7(5-2)6-3;3-1(6)4-5-2(7)8/h4-6H2,1-3H3;(H3,3,4,6)(H2,5,7,8) |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 114.5°C |
| Boiling Point: | 265.7°C at 760 mmHg |
| Density: | g/cm3 |
| Flash Point: | 114.5°C |
| Safety Data |
| |
 |
