| Identification | |
| Name: | a-L-Arabinofuranoside,4-nitrophenyl |
| Synonyms: | Arabinofuranoside,p-nitrophenyl (7CI); Arabinofuranoside, p-nitrophenyl, a-L- (8CI); 4-Nitrophenyl a-L-arabinofuranoside; p-Nitrophenyla-L-arabinofuranoside |
| CAS: | 6892-58-6 |
| Molecular Formula: | C11H13 N O7 |
| Molecular Weight: | 271.22342 |
| InChI: | InChI=1S/C11H13NO7/c13-5-8-9(14)10(15)11(19-8)18-7-3-1-6(2-4-7)12(16)17/h1-4,8-11,13-15H,5H2/t8-,9-,10+,11+/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | HAZARD |
| Flash Point: | 288.7°C |
| Boiling Point: | 553.7°C at 760 mmHg |
| Density: | 1.562g/cm3 |
| Refractive index: | 1.636 |
| Water Solubility: | soluble |
| Solubility: | soluble Appearance:white to slightly yellowish crystalline powder Transport Information:HAZARD Hazard Symbols:UN NO. particular:particular |
| Appearance: | white to slightly yellowish crystalline powder |
| Flash Point: | 288.7°C |
| Storage Temperature: | −20°C |
| Safety Data | |
| Hazard Symbols | |
 |
|
