Identification |
Name: | 2,5-Furandione, polymer with ethenylbenzene, C12-28-alkyl esters, compds. with 2-ethyl-1-hexanamine |
Synonyms: | 2,5-Furandione, polymer with ethenylbenzene, C12-28-alkyl esters, compds. with 2-ethyl-1-hexanamine;2,5-Furandione, polymer with alkyenebenzene, alkyl ester compds. with alkyamine |
CAS: | 68921-25-5 |
Molecular Formula: | C20H29NO3 |
Molecular Weight: | 0 |
InChI: | InChI=1/C8H19N.C8H8.C4H2O3/c1-3-5-6-8(4-2)7-9;1-2-8-6-4-3-5-7-8;5-3-1-2-4(6)7-3/h8H,3-7,9H2,1-2H3;2-7H,1H2;1-2H |
Molecular Structure: |
 |
Properties |
Flash Point: | 52.2°C |
Boiling Point: | 167.3°C at 760 mmHg |
Flash Point: | 52.2°C |
Safety Data |
|
 |