| Identification | |
| Name: | D(-)-Glutamic acid |
| Synonyms: | H-D-Glu-OH;H-DL-Glu-OH;D-Glutaminsaeure;(R)-2-Amino-pentanedioic acid;(2R)-2-azaniumylpentanedioate;Glutamic acid, D-;2-aminopentanedioic acid;D-2-Aminoglutaric acid;D-2-Aminopentanedioic acid;(R)-2-aminopentanedioic acid;(2R)-2-aminopentanedioic acid;D-GLT;D-Glutamate; |
| CAS: | 6893-26-1 |
| EINECS: | 230-000-8 |
| Molecular Formula: | C5H9NO4 |
| Molecular Weight: | 147.13 |
| InChI: | InChI=1S/C5H9NO4/c6-3(5(9)10)1-2-4(7)8/h3H,1-2,6H2,(H,7,8)(H,9,10)/t3-/m0/s1 |
| Molecular Structure: |  |
| Properties | |
| Transport: | 25kgs |
| Melting Point: | 200 C (Decomposes) |
| Density: | 1.409 g/cm3 |
| Stability: | Stable under normal temperatures and pressures. |
| Alpha: | -31.3 o (C=10, 2 N HCL) |
| Water Solubility: | 7 G/L (20 oC) |
| Solubility: | Appearance:white crystals Transport Information:25kgs Hazard Symbols:Not regulated UN NO. |
| Appearance: | white crystals |
| Specification: | White cryst. powder Safety Statements:24/25-36-26 24/25:Avoid contact with skin and eyes 36:Wear suitable protective clothing 26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice |
| HS Code: | 29224200 |
| Biological Activity: | Excitatory amino acid acting at NMDA receptors; less active than the L-isomer. |
| Storage Temperature: | Store at RT. |
| Safety Data | |
| Hazard Symbols | |
 |
|
