| Identification | |
| Name: | 2,6-Octadienal, 3,7-dimethyl-, reaction products with acetone, by-products from, distn. lights |
| Synonyms: | 68937-52-0;Ionone still bottoms;AC1O5UT5;EINECS 272-380-8;EINECS 273-073-1;AG-G-67288;(2E)-3,7-dimethylocta-2,6-dienal; propan-2-one;ACETONE; (2E)-3,7-DIMETHYLOCTA-2,6-DIENAL;2,6-Octadienal, 3,7-dimethyl-, reaction products with acetone, by-products from, distn. lights;2,6-Octadienal, 3,7-dimethyl-, reaction products with acetone, by-products from, distn. residues;68815-52-1 |
| CAS: | 68937-52-0 |
| EINECS: | 273-073-1 |
| Molecular Weight: | 210.315 |
| InChI: | InChI=1/C10H16O.C3H6O/c1-9(2)5-4-6-10(3)7-8-11;1-3(2)4/h5,7-8H,4,6H2,1-3H3;1-2H3/b10-7+; |
| Molecular Structure: |  |
| Properties | |
| Flash Point: | 101.7°C |
| Boiling Point: | 229°Cat760mmHg |
| Density: | g/cm3 |
| Flash Point: | 101.7°C |
| Safety Data | |
 |
|
