| Identification |
| Name: | Carboxylic acids, di-, C6-12, compds. with ethanolamine (1:2) |
| Synonyms: | Carboxylic acids, di-, C6-12, compds. with ethanolamine (1:2);C6-12-Alkyldicarboxylic acid, dimonoethanolamine salt;carboxylic acids, di-, c6-12, compds. with ethanolamine;Carboxylic acids, di-, C6-12-compds. with ethanolamine |
| CAS: | 68937-73-5 |
| Molecular Formula: | C12H28N2O6 |
| Molecular Weight: | 0 |
| InChI: | InChI=1/C8H14O4.2C2H7NO/c9-7(10)5-3-1-2-4-6-8(11)12;2*3-1-2-4/h1-6H2,(H,9,10)(H,11,12);2*4H,1-3H2 |
| Molecular Structure: |
 |
| Properties |
| Flash Point: | 312.8°C |
| Boiling Point: | 593.7°C at 760 mmHg |
| Flash Point: | 312.8°C |
| Safety Data |
| |
 |
